"Pyrogallol" Pronounce,Meaning And Examples
"Pyrogallol" Natural Recordings by Native Speakers
"Pyrogallol" Meaning
Pyrogallol is a chemical compound, a trihydroxybenzene. It is a modification of gallic acid, being obtained by the synthesis of gallic acid with sodium or potassium hydroxide. This compound is a potent disinfectant and is used to treat certain medical conditions. It can be corrosive and cause burns on the skin and in the eyes.
"Pyrogallol" Examples
Word: Pyrogallol
Definition
Pyrogallol is a chemical compound with the formula C6H2(OH)3(OH-CHOH-C6H2OH)2. It is also known as 1,2,3-trihydroxybenzene.Usage Examples
1. Synthesis: Pyrogallol is often used as an oxidation agent to generate 1,2-benzoquinone:
\--->[-2e-][-2H+]
surroundings C6H3(OH)2(OH-CH2OH)-C6H2OH + O
2. Chemical Laboratory: In Hantzsch’s electroweak nitrating mixture: Pyrogallol is simply called a solvent.
3. Polymer processes: Some manufacturers use pyrogallol to repel grease and polish properties.
"Pyrogallol" Similar Words
Pyrococcus
Pyrococcus is a genus of thermophilic archaea, a type of single-celled microbe that lives in extremely hot environments. The name "Pyrococcus" comes from the Greek words "pyro," meaning fire, and "koke", meaning shell or crest.<br><br>Pyrococcus comes from hydrothermal vents and hot springs, where the temperature can reach as high as 122°F (50°C). These microbes have special enzymes that allow them to survive in such extreme conditions, making them of interest for scientists studying the origins of life on Earth.
Pyrocoll
Pyrocrystalline
An adjective that combines "pyro-" (meaning fire or heat) and "-crystalline" (meaning glassy or crystalline structure).<br><br>Pyrocrystalline refers to a type of material, typically a rock or mineral, that contains crystals formed through the action of heat, such as lava or magma. The term often describes rocks that have a glass-like texture, often due to rapid cooling of molten rock.<br><br>In geology, pyrocrystalline rocks are often formed when molten rock cools and solidifies quickly, resulting in a glassy or crystalline texture. These rocks can be found in areas where volcanic activity has been intense, such as around volcanoes, lava flows, and igneous intrusions.
Pyroelectric
Pyroelectrical
Pyroelectricity
Pyrogallate
Pyrogallic
Pyrogallic refers to something related to or containing gallic acid, a type of organic compound. In a broader sense, it can also imply a fiery or burning quality.
Pyrogen
Pyrogenation
Pyrogenic
Pyrogenicity
Pyrogenous
Pyrogens
Pyroglutamate
Pyroglutamic